About (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate (PubChem CID 623166) has the molecular formula C16H30O4
and a molecular weight of 286.41 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate.
Molecular Properties
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate |
| PubChem CID | 623166 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate |
| SMILES | CCCCCCCCCC(=O)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C16H30O4/c1-4-5-6-7-8-9-10-11-15(17)18-12-14-13-19-16(2,3)20-14/h14H,4-13H2,1-3H3 |
| InChIKey | KRBSCYNTGIRIAV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate?
The IUPAC name of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate (CID 623166) is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate.
What is the SMILES notation for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate?
The canonical SMILES for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate is CCCCCCCCCC(=O)OCC1COC(C)(C)O1.
What is the InChIKey of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate?
The InChIKey is KRBSCYNTGIRIAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O4/c1-4-5-6-7-8-9-10-11-15(17)18-12-14-13-19-16(2,3)20-14/h14H,4-13H2,1-3H3.
What are the key properties of (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate?
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate has a molecular weight of 286.41 g/mol, XLogP of 3.82, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-dimethyl-1,3-dioxolan-4-yl)methyl decanoate is sourced from PubChem (CID 623166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).