About 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile
5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile (PubChem CID 62316798) has the molecular formula C16H12BrFN2O
and a molecular weight of 347.19 g/mol. Its IUPAC name is 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile.
Molecular Properties
| Compound Name | 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile |
| PubChem CID | 62316798 |
| Molecular Formula | C16H12BrFN2O |
| Molecular Weight | 347.19 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile |
| SMILES | N#Cc1cc(NC2CCOc3ccc(Br)cc32)ccc1F |
| InChI | InChI=1S/C16H12BrFN2O/c17-11-1-4-16-13(8-11)15(5-6-21-16)20-12-2-3-14(18)10(7-12)9-19/h1-4,7-8,15,20H,5-6H2 |
| InChIKey | RGTWHDIJVBZJDT-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.19 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile?
The IUPAC name of 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile (CID 62316798) is 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile.
What is the SMILES notation for 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile?
The canonical SMILES for 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile is N#Cc1cc(NC2CCOc3ccc(Br)cc32)ccc1F.
What is the InChIKey of 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile?
The InChIKey is RGTWHDIJVBZJDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrFN2O/c17-11-1-4-16-13(8-11)15(5-6-21-16)20-12-2-3-14(18)10(7-12)9-19/h1-4,7-8,15,20H,5-6H2.
What are the key properties of 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile?
5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile has a molecular weight of 347.19 g/mol, XLogP of 4.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(6-bromo-3,4-dihydro-2H-chromen-4-yl)amino]-2-fluorobenzonitrile is sourced from PubChem (CID 62316798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).