C16H14N2OS2 — CID 62317088
2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 62317088) has the molecular formula C16H14N2OS2 and a molecular weight of 314.44 g/mol. Its IUPAC name is 2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 62317088 |
| Molecular Formula | C16H14N2OS2 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.05 |
| IUPAC Name | 2-sulfanylidene-3-(1,2,3,4-tetrahydronaphthalen-2-yl)-1H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | O=c1c2ccsc2[nH]c(=S)n1C1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H14N2OS2/c19-15-13-7-8-21-14(13)17-16(20)18(15)12-6-5-10-3-1-2-4-11(10)9-12/h1-4,7-8,12H,5-6,9H2,(H,17,20) |
| InChIKey | BHIXECBKVORDLB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|