About [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine
[5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine (PubChem CID 62318659) has the molecular formula C11H11F2N3O
and a molecular weight of 239.22 g/mol. Its IUPAC name is [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine |
| PubChem CID | 62318659 |
| Molecular Formula | C11H11F2N3O |
| Molecular Weight | 239.22 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine |
| SMILES | COCc1cc(NN)c2c(F)cc(F)cc2n1 |
| InChI | InChI=1S/C11H11F2N3O/c1-17-5-7-4-10(16-14)11-8(13)2-6(12)3-9(11)15-7/h2-4H,5,14H2,1H3,(H,15,16) |
| InChIKey | BXTAEOINOXIJDE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine?
The IUPAC name of [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine (CID 62318659) is [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine.
What is the SMILES notation for [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine?
The canonical SMILES for [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine is COCc1cc(NN)c2c(F)cc(F)cc2n1.
What is the InChIKey of [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine?
The InChIKey is BXTAEOINOXIJDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2N3O/c1-17-5-7-4-10(16-14)11-8(13)2-6(12)3-9(11)15-7/h2-4H,5,14H2,1H3,(H,15,16).
What are the key properties of [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine?
[5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine has a molecular weight of 239.22 g/mol, XLogP of 1.95, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5,7-difluoro-2-(methoxymethyl)quinolin-4-yl]hydrazine is sourced from PubChem (CID 62318659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).