C13H11ClF3NO2 — CID 62319927
4-chloro-2-(methoxymethyl)-8-(2,2,2-trifluoroethoxy)quinoline (PubChem CID 62319927) has the molecular formula C13H11ClF3NO2 and a molecular weight of 305.68 g/mol. Its IUPAC name is 4-chloro-2-(methoxymethyl)-8-(2,2,2-trifluoroethoxy)quinoline.
| Compound Name | 4-chloro-2-(methoxymethyl)-8-(2,2,2-trifluoroethoxy)quinoline |
|---|---|
| PubChem CID | 62319927 |
| Molecular Formula | C13H11ClF3NO2 |
| Molecular Weight | 305.68 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 4-chloro-2-(methoxymethyl)-8-(2,2,2-trifluoroethoxy)quinoline |
| SMILES | COCc1cc(Cl)c2cccc(OCC(F)(F)F)c2n1 |
| InChI | InChI=1S/C13H11ClF3NO2/c1-19-6-8-5-10(14)9-3-2-4-11(12(9)18-8)20-7-13(15,16)17/h2-5H,6-7H2,1H3 |
| InChIKey | SRNMICWTQZUYOL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.68 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |