About 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine
6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine (PubChem CID 62320038) has the molecular formula C8H10F3N3O
and a molecular weight of 221.18 g/mol. Its IUPAC name is 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| PubChem CID | 62320038 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine |
| SMILES | COCc1cc(N)nc(CC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3N3O/c1-15-4-5-2-6(12)14-7(13-5)3-8(9,10)11/h2H,3-4H2,1H3,(H2,12,13,14) |
| InChIKey | CVCOPRZAOMIHTF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine?
The IUPAC name of 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine (CID 62320038) is 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine.
What is the SMILES notation for 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine?
The canonical SMILES for 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine is COCc1cc(N)nc(CC(F)(F)F)n1.
What is the InChIKey of 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine?
The InChIKey is CVCOPRZAOMIHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3N3O/c1-15-4-5-2-6(12)14-7(13-5)3-8(9,10)11/h2H,3-4H2,1H3,(H2,12,13,14).
What are the key properties of 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine?
6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine has a molecular weight of 221.18 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methoxymethyl)-2-(2,2,2-trifluoroethyl)pyrimidin-4-amine is sourced from PubChem (CID 62320038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).