About 2-bromo-1-methoxyheptane
2-bromo-1-methoxyheptane (PubChem CID 62320387) has the molecular formula C8H17BrO
and a molecular weight of 209.13 g/mol. Its IUPAC name is 2-bromo-1-methoxyheptane.
Molecular Properties
| Compound Name | 2-bromo-1-methoxyheptane |
| PubChem CID | 62320387 |
| Molecular Formula | C8H17BrO |
| Molecular Weight | 209.13 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-bromo-1-methoxyheptane |
| SMILES | CCCCCC(Br)COC |
| InChI | InChI=1S/C8H17BrO/c1-3-4-5-6-8(9)7-10-2/h8H,3-7H2,1-2H3 |
| InChIKey | SJEHSQVHUBPJAK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.13 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-methoxyheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-methoxyheptane?
The IUPAC name of 2-bromo-1-methoxyheptane (CID 62320387) is 2-bromo-1-methoxyheptane.
What is the SMILES notation for 2-bromo-1-methoxyheptane?
The canonical SMILES for 2-bromo-1-methoxyheptane is CCCCCC(Br)COC.
What is the InChIKey of 2-bromo-1-methoxyheptane?
The InChIKey is SJEHSQVHUBPJAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17BrO/c1-3-4-5-6-8(9)7-10-2/h8H,3-7H2,1-2H3.
What are the key properties of 2-bromo-1-methoxyheptane?
2-bromo-1-methoxyheptane has a molecular weight of 209.13 g/mol, XLogP of 2.98, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-methoxyheptane is sourced from PubChem (CID 62320387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).