C11H13N3OS — CID 62320799
6-(methoxymethyl)-2-(3-methylthiophen-2-yl)pyrimidin-4-amine (PubChem CID 62320799) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 6-(methoxymethyl)-2-(3-methylthiophen-2-yl)pyrimidin-4-amine.
| Compound Name | 6-(methoxymethyl)-2-(3-methylthiophen-2-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 62320799 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 6-(methoxymethyl)-2-(3-methylthiophen-2-yl)pyrimidin-4-amine |
| SMILES | COCc1cc(N)nc(-c2sccc2C)n1 |
| InChI | InChI=1S/C11H13N3OS/c1-7-3-4-16-10(7)11-13-8(6-15-2)5-9(12)14-11/h3-5H,6H2,1-2H3,(H2,12,13,14) |
| InChIKey | ZKFALPZXGXTTAV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |