C11H13BrClFO — CID 62321153
1-(3-bromo-4-methoxybutyl)-2-chloro-4-fluorobenzene (PubChem CID 62321153) has the molecular formula C11H13BrClFO and a molecular weight of 295.58 g/mol. Its IUPAC name is 1-(3-bromo-4-methoxybutyl)-2-chloro-4-fluorobenzene.
| Compound Name | 1-(3-bromo-4-methoxybutyl)-2-chloro-4-fluorobenzene |
|---|---|
| PubChem CID | 62321153 |
| Molecular Formula | C11H13BrClFO |
| Molecular Weight | 295.58 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 1-(3-bromo-4-methoxybutyl)-2-chloro-4-fluorobenzene |
| SMILES | COCC(Br)CCc1ccc(F)cc1Cl |
| InChI | InChI=1S/C11H13BrClFO/c1-15-7-9(12)4-2-8-3-5-10(14)6-11(8)13/h3,5-6,9H,2,4,7H2,1H3 |
| InChIKey | RHEYFUXMAXWFFX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|