C16H17ClN2O — CID 62322053
N-[[4-(2-chloro-5-methylphenoxy)-2-pyridinyl]methyl]cyclopropanamine (PubChem CID 62322053) has the molecular formula C16H17ClN2O and a molecular weight of 288.78 g/mol. Its IUPAC name is N-[[4-(2-chloro-5-methylphenoxy)-2-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[4-(2-chloro-5-methylphenoxy)-2-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 62322053 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-[[4-(2-chloro-5-methylphenoxy)-2-pyridinyl]methyl]cyclopropanamine |
| SMILES | Cc1ccc(Cl)c(Oc2ccnc(CNC3CC3)c2)c1 |
| InChI | InChI=1S/C16H17ClN2O/c1-11-2-5-15(17)16(8-11)20-14-6-7-18-13(9-14)10-19-12-3-4-12/h2,5-9,12,19H,3-4,10H2,1H3 |
| InChIKey | XCKUORBHXAJPOZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |