C9H18N2O — CID 62324185
3-(cyclopropylmethylamino)-N-ethylpropanamide (PubChem CID 62324185) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 3-(cyclopropylmethylamino)-N-ethylpropanamide.
| Compound Name | 3-(cyclopropylmethylamino)-N-ethylpropanamide |
|---|---|
| PubChem CID | 62324185 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 3-(cyclopropylmethylamino)-N-ethylpropanamide |
| SMILES | CCNC(=O)CCNCC1CC1 |
| InChI | InChI=1S/C9H18N2O/c1-2-11-9(12)5-6-10-7-8-3-4-8/h8,10H,2-7H2,1H3,(H,11,12) |
| InChIKey | FOHIFQSCWURLMZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|