C14H19NO3 — CID 62324698
4-amino-4-(2,2-dimethyl-3H-1-benzofuran-5-yl)butanoic acid (PubChem CID 62324698) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-amino-4-(2,2-dimethyl-3H-1-benzofuran-5-yl)butanoic acid.
| Compound Name | 4-amino-4-(2,2-dimethyl-3H-1-benzofuran-5-yl)butanoic acid |
|---|---|
| PubChem CID | 62324698 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 4-amino-4-(2,2-dimethyl-3H-1-benzofuran-5-yl)butanoic acid |
| SMILES | CC1(C)Cc2cc(C(N)CCC(=O)O)ccc2O1 |
| InChI | InChI=1S/C14H19NO3/c1-14(2)8-10-7-9(3-5-12(10)18-14)11(15)4-6-13(16)17/h3,5,7,11H,4,6,8,15H2,1-2H3,(H,16,17) |
| InChIKey | XEWUUSDSVRSDBJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |