C13H12F4N2 — CID 623248
5-phenyl-7-(1,1,2,2-tetrafluoroethyl)-2,3-dihydro-1H-1,4-diazepine (PubChem CID 623248) has the molecular formula C13H12F4N2 and a molecular weight of 272.25 g/mol. Its IUPAC name is 5-phenyl-7-(1,1,2,2-tetrafluoroethyl)-2,3-dihydro-1H-1,4-diazepine.
| Compound Name | 5-phenyl-7-(1,1,2,2-tetrafluoroethyl)-2,3-dihydro-1H-1,4-diazepine |
|---|---|
| PubChem CID | 623248 |
| Molecular Formula | C13H12F4N2 |
| Molecular Weight | 272.25 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 5-phenyl-7-(1,1,2,2-tetrafluoroethyl)-2,3-dihydro-1H-1,4-diazepine |
| SMILES | FC(F)C(F)(F)C1=CC(c2ccccc2)=NCCN1 |
| InChI | InChI=1S/C13H12F4N2/c14-12(15)13(16,17)11-8-10(18-6-7-19-11)9-4-2-1-3-5-9/h1-5,8,12,19H,6-7H2 |
| InChIKey | VGZBFFWHTDUILW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.25 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|