About 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide
3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide (PubChem CID 62325353) has the molecular formula C12H11ClN2O3
and a molecular weight of 266.68 g/mol. Its IUPAC name is 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide.
Molecular Properties
| Compound Name | 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide |
| PubChem CID | 62325353 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide |
| SMILES | CNC(=O)CCN1C(=O)C(=O)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H11ClN2O3/c1-14-10(16)4-5-15-9-3-2-7(13)6-8(9)11(17)12(15)18/h2-3,6H,4-5H2,1H3,(H,14,16) |
| InChIKey | NMLZOGGNKFGXCA-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide?
The IUPAC name of 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide (CID 62325353) is 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide.
What is the SMILES notation for 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide?
The canonical SMILES for 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide is CNC(=O)CCN1C(=O)C(=O)c2cc(Cl)ccc21.
What is the InChIKey of 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide?
The InChIKey is NMLZOGGNKFGXCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClN2O3/c1-14-10(16)4-5-15-9-3-2-7(13)6-8(9)11(17)12(15)18/h2-3,6H,4-5H2,1H3,(H,14,16).
What are the key properties of 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide?
3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide has a molecular weight of 266.68 g/mol, XLogP of 1.01, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-chloro-2,3-dioxoindol-1-yl)-N-methylpropanamide is sourced from PubChem (CID 62325353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).