About (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone
(3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone (PubChem CID 62325416) has the molecular formula C17H14F2O2
and a molecular weight of 288.29 g/mol. Its IUPAC name is (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone.
Molecular Properties
| Compound Name | (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone |
| PubChem CID | 62325416 |
| Molecular Formula | C17H14F2O2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone |
| SMILES | CC1(C)Cc2cc(C(=O)c3cc(F)cc(F)c3)ccc2O1 |
| InChI | InChI=1S/C17H14F2O2/c1-17(2)9-12-5-10(3-4-15(12)21-17)16(20)11-6-13(18)8-14(19)7-11/h3-8H,9H2,1-2H3 |
| InChIKey | NLHFGCDUZGPCLB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone?
The IUPAC name of (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone (CID 62325416) is (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone.
What is the SMILES notation for (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone?
The canonical SMILES for (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone is CC1(C)Cc2cc(C(=O)c3cc(F)cc(F)c3)ccc2O1.
What is the InChIKey of (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone?
The InChIKey is NLHFGCDUZGPCLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14F2O2/c1-17(2)9-12-5-10(3-4-15(12)21-17)16(20)11-6-13(18)8-14(19)7-11/h3-8H,9H2,1-2H3.
What are the key properties of (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone?
(3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone has a molecular weight of 288.29 g/mol, XLogP of 3.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-difluorophenyl)-(2,2-dimethyl-3H-1-benzofuran-5-yl)methanone is sourced from PubChem (CID 62325416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).