C12H13N5 — CID 62325597
1-(1H-indol-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine (PubChem CID 62325597) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 1-(1H-indol-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine.
| Compound Name | 1-(1H-indol-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 62325597 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-(1H-indol-3-yl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine |
| SMILES | c1ccc2c(CNCc3ncn[nH]3)c[nH]c2c1 |
| InChI | InChI=1S/C12H13N5/c1-2-4-11-10(3-1)9(6-14-11)5-13-7-12-15-8-16-17-12/h1-4,6,8,13-14H,5,7H2,(H,15,16,17) |
| InChIKey | BTUWWEIYGMIENQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |