About N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine
N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine (PubChem CID 62326172) has the molecular formula C10H17F2N
and a molecular weight of 189.25 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine |
| PubChem CID | 62326172 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCCC1=CCCCC1 |
| InChI | InChI=1S/C10H17F2N/c11-10(12)8-13-7-6-9-4-2-1-3-5-9/h4,10,13H,1-3,5-8H2 |
| InChIKey | QYRGAYPDEGIBRE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine?
The IUPAC name of N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine (CID 62326172) is N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine.
What is the SMILES notation for N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine?
The canonical SMILES for N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine is FC(F)CNCCC1=CCCCC1.
What is the InChIKey of N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine?
The InChIKey is QYRGAYPDEGIBRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N/c11-10(12)8-13-7-6-9-4-2-1-3-5-9/h4,10,13H,1-3,5-8H2.
What are the key properties of N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine?
N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine has a molecular weight of 189.25 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(cyclohexen-1-yl)ethyl]-2,2-difluoroethanamine is sourced from PubChem (CID 62326172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).