C9H14F3N3 — CID 62326527
N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2,2,2-trifluoroethanamine (PubChem CID 62326527) has the molecular formula C9H14F3N3 and a molecular weight of 221.23 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2,2,2-trifluoroethanamine.
| Compound Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2,2,2-trifluoroethanamine |
|---|---|
| PubChem CID | 62326527 |
| Molecular Formula | C9H14F3N3 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-2,2,2-trifluoroethanamine |
| SMILES | Cc1n[nH]c(C)c1CCNCC(F)(F)F |
| InChI | InChI=1S/C9H14F3N3/c1-6-8(7(2)15-14-6)3-4-13-5-9(10,11)12/h13H,3-5H2,1-2H3,(H,14,15) |
| InChIKey | QANBUVWORYPZMU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|