C10H22N2O — CID 62327223
N,N-diethyl-2-pyrrolidin-3-yloxyethanamine (PubChem CID 62327223) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is N,N-diethyl-2-pyrrolidin-3-yloxyethanamine.
| Compound Name | N,N-diethyl-2-pyrrolidin-3-yloxyethanamine |
|---|---|
| PubChem CID | 62327223 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | N,N-diethyl-2-pyrrolidin-3-yloxyethanamine |
| SMILES | CCN(CC)CCOC1CCNC1 |
| InChI | InChI=1S/C10H22N2O/c1-3-12(4-2)7-8-13-10-5-6-11-9-10/h10-11H,3-9H2,1-2H3 |
| InChIKey | YUEZSYRTENWHAQ-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |