C12H17BrN2 — CID 62327410
N-[(3-bromophenyl)methyl]-N-methylpyrrolidin-3-amine (PubChem CID 62327410) has the molecular formula C12H17BrN2 and a molecular weight of 269.19 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-N-methylpyrrolidin-3-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-N-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 62327410 |
| Molecular Formula | C12H17BrN2 |
| Molecular Weight | 269.19 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-N-methylpyrrolidin-3-amine |
| SMILES | CN(Cc1cccc(Br)c1)C1CCNC1 |
| InChI | InChI=1S/C12H17BrN2/c1-15(12-5-6-14-8-12)9-10-3-2-4-11(13)7-10/h2-4,7,12,14H,5-6,8-9H2,1H3 |
| InChIKey | LFJCGEQWZVQZEN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |