About 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine
3-[(2,6-dichlorophenyl)methoxy]pyrrolidine (PubChem CID 62328259) has the molecular formula C11H13Cl2NO
and a molecular weight of 246.14 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine.
Molecular Properties
| Compound Name | 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine |
| PubChem CID | 62328259 |
| Molecular Formula | C11H13Cl2NO |
| Molecular Weight | 246.14 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine |
| SMILES | Clc1cccc(Cl)c1COC1CCNC1 |
| InChI | InChI=1S/C11H13Cl2NO/c12-10-2-1-3-11(13)9(10)7-15-8-4-5-14-6-8/h1-3,8,14H,4-7H2 |
| InChIKey | BJHZHQLWJUFPIN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.14 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine?
The IUPAC name of 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine (CID 62328259) is 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine.
What is the SMILES notation for 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine?
The canonical SMILES for 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine is Clc1cccc(Cl)c1COC1CCNC1.
What is the InChIKey of 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine?
The InChIKey is BJHZHQLWJUFPIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NO/c12-10-2-1-3-11(13)9(10)7-15-8-4-5-14-6-8/h1-3,8,14H,4-7H2.
What are the key properties of 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine?
3-[(2,6-dichlorophenyl)methoxy]pyrrolidine has a molecular weight of 246.14 g/mol, XLogP of 2.87, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,6-dichlorophenyl)methoxy]pyrrolidine is sourced from PubChem (CID 62328259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).