About 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine
2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine (PubChem CID 62328822) has the molecular formula C10H13BrN4
and a molecular weight of 269.15 g/mol. Its IUPAC name is 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine.
Molecular Properties
| Compound Name | 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine |
| PubChem CID | 62328822 |
| Molecular Formula | C10H13BrN4 |
| Molecular Weight | 269.15 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine |
| SMILES | CCNCCc1nc2ncc(Br)cc2[nH]1 |
| InChI | InChI=1S/C10H13BrN4/c1-2-12-4-3-9-14-8-5-7(11)6-13-10(8)15-9/h5-6,12H,2-4H2,1H3,(H,13,14,15) |
| InChIKey | NXNWJTHTELYREZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine?
The IUPAC name of 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine (CID 62328822) is 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine.
What is the SMILES notation for 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine?
The canonical SMILES for 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine is CCNCCc1nc2ncc(Br)cc2[nH]1.
What is the InChIKey of 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine?
The InChIKey is NXNWJTHTELYREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN4/c1-2-12-4-3-9-14-8-5-7(11)6-13-10(8)15-9/h5-6,12H,2-4H2,1H3,(H,13,14,15).
What are the key properties of 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine?
2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine has a molecular weight of 269.15 g/mol, XLogP of 1.87, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-1H-imidazo[4,5-b]pyridin-2-yl)-N-ethylethanamine is sourced from PubChem (CID 62328822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).