C10H16N2O2 — CID 62329466
1-pyrrolidin-3-ylazepane-2,7-dione (PubChem CID 62329466) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-pyrrolidin-3-ylazepane-2,7-dione.
| Compound Name | 1-pyrrolidin-3-ylazepane-2,7-dione |
|---|---|
| PubChem CID | 62329466 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1-pyrrolidin-3-ylazepane-2,7-dione |
| SMILES | O=C1CCCCC(=O)N1C1CCNC1 |
| InChI | InChI=1S/C10H16N2O2/c13-9-3-1-2-4-10(14)12(9)8-5-6-11-7-8/h8,11H,1-7H2 |
| InChIKey | CNEHHCDODSWNCI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|