C17H27FN2 — CID 62329945
1-(2,4-dimethylpiperidin-1-yl)-1-(4-fluorophenyl)butan-2-amine (PubChem CID 62329945) has the molecular formula C17H27FN2 and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-(2,4-dimethylpiperidin-1-yl)-1-(4-fluorophenyl)butan-2-amine.
| Compound Name | 1-(2,4-dimethylpiperidin-1-yl)-1-(4-fluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 62329945 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-(2,4-dimethylpiperidin-1-yl)-1-(4-fluorophenyl)butan-2-amine |
| SMILES | CCC(N)C(c1ccc(F)cc1)N1CCC(C)CC1C |
| InChI | InChI=1S/C17H27FN2/c1-4-16(19)17(14-5-7-15(18)8-6-14)20-10-9-12(2)11-13(20)3/h5-8,12-13,16-17H,4,9-11,19H2,1-3H3 |
| InChIKey | ZQUOVFDWQQKZDK-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |