About 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde
3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde (PubChem CID 62330700) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde.
Molecular Properties
| Compound Name | 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde |
| PubChem CID | 62330700 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde |
| SMILES | COc1ccc(C=O)cc1CN1CCC(C)CC1C |
| InChI | InChI=1S/C16H23NO2/c1-12-6-7-17(13(2)8-12)10-15-9-14(11-18)4-5-16(15)19-3/h4-5,9,11-13H,6-8,10H2,1-3H3 |
| InChIKey | JOICKJLUDCWWFP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde?
The IUPAC name of 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde (CID 62330700) is 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde.
What is the SMILES notation for 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde?
The canonical SMILES for 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde is COc1ccc(C=O)cc1CN1CCC(C)CC1C.
What is the InChIKey of 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde?
The InChIKey is JOICKJLUDCWWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO2/c1-12-6-7-17(13(2)8-12)10-15-9-14(11-18)4-5-16(15)19-3/h4-5,9,11-13H,6-8,10H2,1-3H3.
What are the key properties of 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde?
3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde has a molecular weight of 261.37 g/mol, XLogP of 3.13, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,4-dimethylpiperidin-1-yl)methyl]-4-methoxybenzaldehyde is sourced from PubChem (CID 62330700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).