C13H18Cl2N2 — CID 62331827
3-chloro-5-(chloromethyl)-2-(2,4-dimethylpiperidin-1-yl)pyridine (PubChem CID 62331827) has the molecular formula C13H18Cl2N2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 3-chloro-5-(chloromethyl)-2-(2,4-dimethylpiperidin-1-yl)pyridine.
| Compound Name | 3-chloro-5-(chloromethyl)-2-(2,4-dimethylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 62331827 |
| Molecular Formula | C13H18Cl2N2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 3-chloro-5-(chloromethyl)-2-(2,4-dimethylpiperidin-1-yl)pyridine |
| SMILES | CC1CCN(c2ncc(CCl)cc2Cl)C(C)C1 |
| InChI | InChI=1S/C13H18Cl2N2/c1-9-3-4-17(10(2)5-9)13-12(15)6-11(7-14)8-16-13/h6,8-10H,3-5,7H2,1-2H3 |
| InChIKey | CGZPCWBCQGPVLY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|