About 1-(3-chloropropyl)-2,4-dimethylpiperidine
1-(3-chloropropyl)-2,4-dimethylpiperidine (PubChem CID 62332524) has the molecular formula C10H20ClN
and a molecular weight of 189.73 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2,4-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-(3-chloropropyl)-2,4-dimethylpiperidine |
| PubChem CID | 62332524 |
| Molecular Formula | C10H20ClN |
| Molecular Weight | 189.73 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(3-chloropropyl)-2,4-dimethylpiperidine |
| SMILES | CC1CCN(CCCCl)C(C)C1 |
| InChI | InChI=1S/C10H20ClN/c1-9-4-7-12(6-3-5-11)10(2)8-9/h9-10H,3-8H2,1-2H3 |
| InChIKey | XFTDNKIPFGWEHP-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropyl)-2,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropyl)-2,4-dimethylpiperidine?
The IUPAC name of 1-(3-chloropropyl)-2,4-dimethylpiperidine (CID 62332524) is 1-(3-chloropropyl)-2,4-dimethylpiperidine.
What is the SMILES notation for 1-(3-chloropropyl)-2,4-dimethylpiperidine?
The canonical SMILES for 1-(3-chloropropyl)-2,4-dimethylpiperidine is CC1CCN(CCCCl)C(C)C1.
What is the InChIKey of 1-(3-chloropropyl)-2,4-dimethylpiperidine?
The InChIKey is XFTDNKIPFGWEHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClN/c1-9-4-7-12(6-3-5-11)10(2)8-9/h9-10H,3-8H2,1-2H3.
What are the key properties of 1-(3-chloropropyl)-2,4-dimethylpiperidine?
1-(3-chloropropyl)-2,4-dimethylpiperidine has a molecular weight of 189.73 g/mol, XLogP of 2.74, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-2,4-dimethylpiperidine is sourced from PubChem (CID 62332524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).