C11H17ClN2O — CID 62333630
1-[(5-amino-2-chlorophenyl)methyl-methylamino]propan-2-ol (PubChem CID 62333630) has the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. Its IUPAC name is 1-[(5-amino-2-chlorophenyl)methyl-methylamino]propan-2-ol.
| Compound Name | 1-[(5-amino-2-chlorophenyl)methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 62333630 |
| Molecular Formula | C11H17ClN2O |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-[(5-amino-2-chlorophenyl)methyl-methylamino]propan-2-ol |
| SMILES | CC(O)CN(C)Cc1cc(N)ccc1Cl |
| InChI | InChI=1S/C11H17ClN2O/c1-8(15)6-14(2)7-9-5-10(13)3-4-11(9)12/h3-5,8,15H,6-7,13H2,1-2H3 |
| InChIKey | RUYLYFDJWRJRCT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|