C10H14N2O3 — CID 62335652
2-[2-hydroxypropyl(methyl)amino]pyridine-3-carboxylic acid (PubChem CID 62335652) has the molecular formula C10H14N2O3 and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-[2-hydroxypropyl(methyl)amino]pyridine-3-carboxylic acid.
| Compound Name | 2-[2-hydroxypropyl(methyl)amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 62335652 |
| Molecular Formula | C10H14N2O3 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 2-[2-hydroxypropyl(methyl)amino]pyridine-3-carboxylic acid |
| SMILES | CC(O)CN(C)c1ncccc1C(=O)O |
| InChI | InChI=1S/C10H14N2O3/c1-7(13)6-12(2)9-8(10(14)15)4-3-5-11-9/h3-5,7,13H,6H2,1-2H3,(H,14,15) |
| InChIKey | VARVLTINGOANOY-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 73.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |