C13H21N5OS — CID 62336235
1-[(4-hydrazinyl-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propan-2-ol (PubChem CID 62336235) has the molecular formula C13H21N5OS and a molecular weight of 295.41 g/mol. Its IUPAC name is 1-[(4-hydrazinyl-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propan-2-ol.
| Compound Name | 1-[(4-hydrazinyl-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propan-2-ol |
|---|---|
| PubChem CID | 62336235 |
| Molecular Formula | C13H21N5OS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-[(4-hydrazinyl-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propan-2-ol |
| SMILES | Cc1sc2nc(CN(C)CC(C)O)nc(NN)c2c1C |
| InChI | InChI=1S/C13H21N5OS/c1-7(19)5-18(4)6-10-15-12(17-14)11-8(2)9(3)20-13(11)16-10/h7,19H,5-6,14H2,1-4H3,(H,15,16,17) |
| InChIKey | AOVYYIVSRJZGTA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|