C17H10F10N6 — CID 623376
6-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 623376) has the molecular formula C17H10F10N6 and a molecular weight of 488.29 g/mol. Its IUPAC name is 6-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 623376 |
| Molecular Formula | C17H10F10N6 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | 6-[4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]piperazin-1-yl]-3-(trifluoromethyl)-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Fc1c(F)c(C(F)(F)F)c(F)c(F)c1N1CCN(c2ccc3nnc(C(F)(F)F)n3n2)CC1 |
| InChI | InChI=1S/C17H10F10N6/c18-10-9(16(22,23)24)11(19)13(21)14(12(10)20)32-5-3-31(4-6-32)8-2-1-7-28-29-15(17(25,26)27)33(7)30-8/h1-2H,3-6H2 |
| InChIKey | FQUIFMDFGKPAFI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|