C10H13N3OS — CID 62339475
N-(1-amino-1-sulfanylidenepropan-2-yl)-3-methylpyridine-2-carboxamide (PubChem CID 62339475) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is N-(1-amino-1-sulfanylidenepropan-2-yl)-3-methylpyridine-2-carboxamide.
| Compound Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 62339475 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | N-(1-amino-1-sulfanylidenepropan-2-yl)-3-methylpyridine-2-carboxamide |
| SMILES | Cc1cccnc1C(=O)NC(C)C(N)=S |
| InChI | InChI=1S/C10H13N3OS/c1-6-4-3-5-12-8(6)10(14)13-7(2)9(11)15/h3-5,7H,1-2H3,(H2,11,15)(H,13,14) |
| InChIKey | GLXVIUHUPRYXDM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|