C11H18N2O — CID 62339579
2-(oxolan-2-yl)-N-(1H-pyrrol-2-ylmethyl)ethanamine (PubChem CID 62339579) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-N-(1H-pyrrol-2-ylmethyl)ethanamine.
| Compound Name | 2-(oxolan-2-yl)-N-(1H-pyrrol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 62339579 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-(oxolan-2-yl)-N-(1H-pyrrol-2-ylmethyl)ethanamine |
| SMILES | c1c[nH]c(CNCCC2CCCO2)c1 |
| InChI | InChI=1S/C11H18N2O/c1-3-10(13-6-1)9-12-7-5-11-4-2-8-14-11/h1,3,6,11-13H,2,4-5,7-9H2 |
| InChIKey | VOTTZGFSDRVHSG-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|