C16H24N2O2 — CID 62339975
N-[(3-methoxyphenyl)methyl]-N,3-dimethylpiperidine-2-carboxamide (PubChem CID 62339975) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-N,3-dimethylpiperidine-2-carboxamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-N,3-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 62339975 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-N,3-dimethylpiperidine-2-carboxamide |
| SMILES | COc1cccc(CN(C)C(=O)C2NCCCC2C)c1 |
| InChI | InChI=1S/C16H24N2O2/c1-12-6-5-9-17-15(12)16(19)18(2)11-13-7-4-8-14(10-13)20-3/h4,7-8,10,12,15,17H,5-6,9,11H2,1-3H3 |
| InChIKey | KLXLMULFQFOKEI-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |