C13H21NO2 — CID 62342923
(E)-4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)but-2-enoic acid (PubChem CID 62342923) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is (E)-4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)but-2-enoic acid.
| Compound Name | (E)-4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)but-2-enoic acid |
|---|---|
| PubChem CID | 62342923 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | (E)-4-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)but-2-enoic acid |
| SMILES | O=C(O)/C=C/CN1CCCC2CCCCC21 |
| InChI | InChI=1S/C13H21NO2/c15-13(16)8-4-10-14-9-3-6-11-5-1-2-7-12(11)14/h4,8,11-12H,1-3,5-7,9-10H2,(H,15,16)/b8-4+ |
| InChIKey | HQVLGWBGCPZYTG-XBXARRHUSA-N |
| XLogP | 2.28 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|