About 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine
1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine (PubChem CID 62344410) has the molecular formula C11H15N5O
and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine |
| PubChem CID | 62344410 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(OC3CCNCC3)ncnc21 |
| InChI | InChI=1S/C11H15N5O/c1-16-10-9(6-15-16)11(14-7-13-10)17-8-2-4-12-5-3-8/h6-8,12H,2-5H2,1H3 |
| InChIKey | GLRXFFQAYWBARN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine?
The IUPAC name of 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine (CID 62344410) is 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine is Cn1ncc2c(OC3CCNCC3)ncnc21.
What is the InChIKey of 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine?
The InChIKey is GLRXFFQAYWBARN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N5O/c1-16-10-9(6-15-16)11(14-7-13-10)17-8-2-4-12-5-3-8/h6-8,12H,2-5H2,1H3.
What are the key properties of 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine?
1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine has a molecular weight of 233.27 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-piperidin-4-yloxypyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 62344410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).