C13H22N2OS — CID 62345916
2-(5-ethylthiophen-2-yl)-2-(2-methylmorpholin-4-yl)ethanamine (PubChem CID 62345916) has the molecular formula C13H22N2OS and a molecular weight of 254.40 g/mol. Its IUPAC name is 2-(5-ethylthiophen-2-yl)-2-(2-methylmorpholin-4-yl)ethanamine.
| Compound Name | 2-(5-ethylthiophen-2-yl)-2-(2-methylmorpholin-4-yl)ethanamine |
|---|---|
| PubChem CID | 62345916 |
| Molecular Formula | C13H22N2OS |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | 2-(5-ethylthiophen-2-yl)-2-(2-methylmorpholin-4-yl)ethanamine |
| SMILES | CCc1ccc(C(CN)N2CCOC(C)C2)s1 |
| InChI | InChI=1S/C13H22N2OS/c1-3-11-4-5-13(17-11)12(8-14)15-6-7-16-10(2)9-15/h4-5,10,12H,3,6-9,14H2,1-2H3 |
| InChIKey | MOCZRXZKRYXWDW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |