C13H16N2O2 — CID 62345999
5-[(5-ethylfuran-2-yl)methylamino]-1-methylpyridin-2-one (PubChem CID 62345999) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-[(5-ethylfuran-2-yl)methylamino]-1-methylpyridin-2-one.
| Compound Name | 5-[(5-ethylfuran-2-yl)methylamino]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 62345999 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-[(5-ethylfuran-2-yl)methylamino]-1-methylpyridin-2-one |
| SMILES | CCc1ccc(CNc2ccc(=O)n(C)c2)o1 |
| InChI | InChI=1S/C13H16N2O2/c1-3-11-5-6-12(17-11)8-14-10-4-7-13(16)15(2)9-10/h4-7,9,14H,3,8H2,1-2H3 |
| InChIKey | CMFQKFSZHVFJFP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |