About [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine
[2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 62347401) has the molecular formula C10H12N2OS
and a molecular weight of 208.29 g/mol. Its IUPAC name is [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine |
| PubChem CID | 62347401 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | CCc1ccc(-c2ncc(CN)s2)o1 |
| InChI | InChI=1S/C10H12N2OS/c1-2-7-3-4-9(13-7)10-12-6-8(5-11)14-10/h3-4,6H,2,5,11H2,1H3 |
| InChIKey | KLBSOTFYBXFUHW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine?
The IUPAC name of [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine (CID 62347401) is [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine.
What is the SMILES notation for [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine?
The canonical SMILES for [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine is CCc1ccc(-c2ncc(CN)s2)o1.
What is the InChIKey of [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine?
The InChIKey is KLBSOTFYBXFUHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2OS/c1-2-7-3-4-9(13-7)10-12-6-8(5-11)14-10/h3-4,6H,2,5,11H2,1H3.
What are the key properties of [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine?
[2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine has a molecular weight of 208.29 g/mol, XLogP of 2.42, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-ethylfuran-2-yl)-1,3-thiazol-5-yl]methanamine is sourced from PubChem (CID 62347401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).