C10H13N3O2 — CID 62347808
2-pyrrolidin-3-yloxypyridine-3-carboxamide (PubChem CID 62347808) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-pyrrolidin-3-yloxypyridine-3-carboxamide.
| Compound Name | 2-pyrrolidin-3-yloxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 62347808 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-pyrrolidin-3-yloxypyridine-3-carboxamide |
| SMILES | NC(=O)c1cccnc1OC1CCNC1 |
| InChI | InChI=1S/C10H13N3O2/c11-9(14)8-2-1-4-13-10(8)15-7-3-5-12-6-7/h1-2,4,7,12H,3,5-6H2,(H2,11,14) |
| InChIKey | CYHUAKZAIMMPQE-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |