C11H15NO2S — CID 62349580
1-[3-(hydroxymethyl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone (PubChem CID 62349580) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 1-[3-(hydroxymethyl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[3-(hydroxymethyl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 62349580 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 1-[3-(hydroxymethyl)pyrrolidin-1-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CCC(CO)C1 |
| InChI | InChI=1S/C11H15NO2S/c13-7-10-1-3-12(6-10)11(14)5-9-2-4-15-8-9/h2,4,8,10,13H,1,3,5-7H2 |
| InChIKey | ZEOUHLSCFDNDOU-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |