C14H14N2O — CID 62349991
3-naphthalen-2-ylpiperazin-2-one (PubChem CID 62349991) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 3-naphthalen-2-ylpiperazin-2-one.
| Compound Name | 3-naphthalen-2-ylpiperazin-2-one |
|---|---|
| PubChem CID | 62349991 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 3-naphthalen-2-ylpiperazin-2-one |
| SMILES | O=C1NCCNC1c1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H14N2O/c17-14-13(15-7-8-16-14)12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13,15H,7-8H2,(H,16,17) |
| InChIKey | AOCSMUHMHHJOCK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |