3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid

C9H14N2O2 — CID 62350018

IUPAC3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid
SMILESCc1ncn(CC(C)C(=O)O)c1C
InChIInChI=1S/C9H14N2O2/c1-6(9(12)13)4-11-5-10-7(2)8(11)3/h5-6H,4H2,1-3H3,(H,12,13)
InChIKeyXWYYACCIHOXADJ-UHFFFAOYSA-N
MW182.22 g/mol
LogP1.22
Rot. Bonds3

About 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid

3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid (PubChem CID 62350018) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid.

Molecular Properties

Compound Name3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid
PubChem CID62350018
Molecular FormulaC9H14N2O2
Molecular Weight182.22 g/mol
Exact Mass182.11
IUPAC Name3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid
SMILESCc1ncn(CC(C)C(=O)O)c1C
InChIInChI=1S/C9H14N2O2/c1-6(9(12)13)4-11-5-10-7(2)8(11)3/h5-6H,4H2,1-3H3,(H,12,13)
InChIKeyXWYYACCIHOXADJ-UHFFFAOYSA-N
XLogP1.22
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.22
LogP ≤ 51.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid?
The IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid (CID 62350018) is 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid.
What is the SMILES notation for 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid?
The canonical SMILES for 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid is Cc1ncn(CC(C)C(=O)O)c1C.
What is the InChIKey of 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid?
The InChIKey is XWYYACCIHOXADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-6(9(12)13)4-11-5-10-7(2)8(11)3/h5-6H,4H2,1-3H3,(H,12,13).
What are the key properties of 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid?
3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid has a molecular weight of 182.22 g/mol, XLogP of 1.22, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethylimidazol-1-yl)-2-methylpropanoic acid is sourced from PubChem (CID 62350018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).