About 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol
2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol (PubChem CID 62350080) has the molecular formula C12H20N2O
and a molecular weight of 208.30 g/mol. Its IUPAC name is 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol.
Molecular Properties
| Compound Name | 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol |
| PubChem CID | 62350080 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol |
| SMILES | Cc1ncn(C2CC(C)CCC2O)c1C |
| InChI | InChI=1S/C12H20N2O/c1-8-4-5-12(15)11(6-8)14-7-13-9(2)10(14)3/h7-8,11-12,15H,4-6H2,1-3H3 |
| InChIKey | CMUVIXXXJRDYFY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol?
The IUPAC name of 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol (CID 62350080) is 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol.
What is the SMILES notation for 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol?
The canonical SMILES for 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol is Cc1ncn(C2CC(C)CCC2O)c1C.
What is the InChIKey of 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol?
The InChIKey is CMUVIXXXJRDYFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O/c1-8-4-5-12(15)11(6-8)14-7-13-9(2)10(14)3/h7-8,11-12,15H,4-6H2,1-3H3.
What are the key properties of 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol?
2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol has a molecular weight of 208.30 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethylimidazol-1-yl)-4-methylcyclohexan-1-ol is sourced from PubChem (CID 62350080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).