About 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine
1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine (PubChem CID 62350364) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine.
Molecular Properties
| Compound Name | 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine |
| PubChem CID | 62350364 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine |
| SMILES | CCCC(Cn1cnc(C)c1C)NC |
| InChI | InChI=1S/C11H21N3/c1-5-6-11(12-4)7-14-8-13-9(2)10(14)3/h8,11-12H,5-7H2,1-4H3 |
| InChIKey | PEYHSSIVWSWNJN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine?
The IUPAC name of 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine (CID 62350364) is 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine.
What is the SMILES notation for 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine?
The canonical SMILES for 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine is CCCC(Cn1cnc(C)c1C)NC.
What is the InChIKey of 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine?
The InChIKey is PEYHSSIVWSWNJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-5-6-11(12-4)7-14-8-13-9(2)10(14)3/h8,11-12H,5-7H2,1-4H3.
What are the key properties of 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine?
1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine has a molecular weight of 195.31 g/mol, XLogP of 1.89, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-dimethylimidazol-1-yl)-N-methylpentan-2-amine is sourced from PubChem (CID 62350364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).