C13H11F2N3O — CID 62350431
N-[5-(aminomethyl)-2-pyridinyl]-2,4-difluorobenzamide (PubChem CID 62350431) has the molecular formula C13H11F2N3O and a molecular weight of 263.25 g/mol. Its IUPAC name is N-[5-(aminomethyl)-2-pyridinyl]-2,4-difluorobenzamide.
| Compound Name | N-[5-(aminomethyl)-2-pyridinyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 62350431 |
| Molecular Formula | C13H11F2N3O |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | N-[5-(aminomethyl)-2-pyridinyl]-2,4-difluorobenzamide |
| SMILES | NCc1ccc(NC(=O)c2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C13H11F2N3O/c14-9-2-3-10(11(15)5-9)13(19)18-12-4-1-8(6-16)7-17-12/h1-5,7H,6,16H2,(H,17,18,19) |
| InChIKey | GGKWTBLVLISVGQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |