About 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine
6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine (PubChem CID 62350906) has the molecular formula C12H23N3
and a molecular weight of 209.34 g/mol. Its IUPAC name is 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine.
Molecular Properties
| Compound Name | 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine |
| PubChem CID | 62350906 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine |
| SMILES | CNC(C)CCCCn1cnc(C)c1C |
| InChI | InChI=1S/C12H23N3/c1-10(13-4)7-5-6-8-15-9-14-11(2)12(15)3/h9-10,13H,5-8H2,1-4H3 |
| InChIKey | SQZXFOZPWWZKMN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine?
The IUPAC name of 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine (CID 62350906) is 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine.
What is the SMILES notation for 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine?
The canonical SMILES for 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine is CNC(C)CCCCn1cnc(C)c1C.
What is the InChIKey of 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine?
The InChIKey is SQZXFOZPWWZKMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N3/c1-10(13-4)7-5-6-8-15-9-14-11(2)12(15)3/h9-10,13H,5-8H2,1-4H3.
What are the key properties of 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine?
6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine has a molecular weight of 209.34 g/mol, XLogP of 2.28, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4,5-dimethylimidazol-1-yl)-N-methylhexan-2-amine is sourced from PubChem (CID 62350906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).