About 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine
3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine (PubChem CID 62351281) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine |
| PubChem CID | 62351281 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine |
| SMILES | CCNCCCn1cnc(C)c1C |
| InChI | InChI=1S/C10H19N3/c1-4-11-6-5-7-13-8-12-9(2)10(13)3/h8,11H,4-7H2,1-3H3 |
| InChIKey | PVFIOBYKFUNSIP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine?
The IUPAC name of 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine (CID 62351281) is 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine.
What is the SMILES notation for 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine?
The canonical SMILES for 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine is CCNCCCn1cnc(C)c1C.
What is the InChIKey of 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine?
The InChIKey is PVFIOBYKFUNSIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-4-11-6-5-7-13-8-12-9(2)10(13)3/h8,11H,4-7H2,1-3H3.
What are the key properties of 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine?
3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine has a molecular weight of 181.28 g/mol, XLogP of 1.50, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethylimidazol-1-yl)-N-ethylpropan-1-amine is sourced from PubChem (CID 62351281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).