About 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol
3-(4,5-dimethylimidazol-1-yl)heptan-4-ol (PubChem CID 62351287) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol.
Molecular Properties
| Compound Name | 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol |
| PubChem CID | 62351287 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol |
| SMILES | CCCC(O)C(CC)n1cnc(C)c1C |
| InChI | InChI=1S/C12H22N2O/c1-5-7-12(15)11(6-2)14-8-13-9(3)10(14)4/h8,11-12,15H,5-7H2,1-4H3 |
| InChIKey | HAQLHYLINDIRDQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol?
The IUPAC name of 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol (CID 62351287) is 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol.
What is the SMILES notation for 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol?
The canonical SMILES for 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol is CCCC(O)C(CC)n1cnc(C)c1C.
What is the InChIKey of 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol?
The InChIKey is HAQLHYLINDIRDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O/c1-5-7-12(15)11(6-2)14-8-13-9(3)10(14)4/h8,11-12,15H,5-7H2,1-4H3.
What are the key properties of 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol?
3-(4,5-dimethylimidazol-1-yl)heptan-4-ol has a molecular weight of 210.32 g/mol, XLogP of 2.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethylimidazol-1-yl)heptan-4-ol is sourced from PubChem (CID 62351287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).