C13H21N5 — CID 62351544
N-[(1-ethylimidazol-2-yl)methyl]-4-imidazol-1-ylbutan-1-amine (PubChem CID 62351544) has the molecular formula C13H21N5 and a molecular weight of 247.35 g/mol. Its IUPAC name is N-[(1-ethylimidazol-2-yl)methyl]-4-imidazol-1-ylbutan-1-amine.
| Compound Name | N-[(1-ethylimidazol-2-yl)methyl]-4-imidazol-1-ylbutan-1-amine |
|---|---|
| PubChem CID | 62351544 |
| Molecular Formula | C13H21N5 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.18 |
| IUPAC Name | N-[(1-ethylimidazol-2-yl)methyl]-4-imidazol-1-ylbutan-1-amine |
| SMILES | CCn1ccnc1CNCCCCn1ccnc1 |
| InChI | InChI=1S/C13H21N5/c1-2-18-10-7-16-13(18)11-14-5-3-4-8-17-9-6-15-12-17/h6-7,9-10,12,14H,2-5,8,11H2,1H3 |
| InChIKey | NVQNDVAEVHIROH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|